About 1-(4-methyl-5-methylsulfonyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one
1-(4-methyl-5-methylsulfonyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one (PubChem CID 170974471) has the molecular formula C9H13N3O3S2
and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-(4-methyl-5-methylsulfonyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-(4-methyl-5-methylsulfonyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one |
| PubChem CID | 170974471 |
| Molecular Formula | C9H13N3O3S2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 1-(4-methyl-5-methylsulfonyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one |
| SMILES | Cc1nc(N2CCCNC2=O)sc1S(C)(=O)=O |
| InChI | InChI=1S/C9H13N3O3S2/c1-6-7(17(2,14)15)16-9(11-6)12-5-3-4-10-8(12)13/h3-5H2,1-2H3,(H,10,13) |
| InChIKey | HUOFYTHLFVIGJT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-methyl-5-methylsulfonyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-5-methylsulfonyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one?
The IUPAC name of 1-(4-methyl-5-methylsulfonyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one (CID 170974471) is 1-(4-methyl-5-methylsulfonyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one.
What is the SMILES notation for 1-(4-methyl-5-methylsulfonyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one?
The canonical SMILES for 1-(4-methyl-5-methylsulfonyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one is Cc1nc(N2CCCNC2=O)sc1S(C)(=O)=O.
What is the InChIKey of 1-(4-methyl-5-methylsulfonyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one?
The InChIKey is HUOFYTHLFVIGJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O3S2/c1-6-7(17(2,14)15)16-9(11-6)12-5-3-4-10-8(12)13/h3-5H2,1-2H3,(H,10,13).
What are the key properties of 1-(4-methyl-5-methylsulfonyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one?
1-(4-methyl-5-methylsulfonyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one has a molecular weight of 275.35 g/mol, XLogP of 0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-5-methylsulfonyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one is sourced from PubChem (CID 170974471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).