About methyl 5-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)pyridine-2-carboxylate;hydrochloride
methyl 5-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)pyridine-2-carboxylate;hydrochloride (PubChem CID 170975594) has the molecular formula C15H19ClF2N2O2
and a molecular weight of 332.78 g/mol. Its IUPAC name is methyl 5-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)pyridine-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 5-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)pyridine-2-carboxylate;hydrochloride |
| PubChem CID | 170975594 |
| Molecular Formula | C15H19ClF2N2O2 |
| Molecular Weight | 332.78 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | methyl 5-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)pyridine-2-carboxylate;hydrochloride |
| SMILES | COC(=O)c1ccc(C2CC3(CCN2)CC(F)(F)C3)cn1.Cl |
| InChI | InChI=1S/C15H18F2N2O2.ClH/c1-21-13(20)11-3-2-10(7-19-11)12-6-14(4-5-18-12)8-15(16,17)9-14;/h2-3,7,12,18H,4-6,8-9H2,1H3;1H |
| InChIKey | NNTWLNWUAGMEGQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.78 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)pyridine-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)pyridine-2-carboxylate;hydrochloride?
The IUPAC name of methyl 5-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)pyridine-2-carboxylate;hydrochloride (CID 170975594) is methyl 5-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)pyridine-2-carboxylate;hydrochloride.
What is the SMILES notation for methyl 5-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)pyridine-2-carboxylate;hydrochloride?
The canonical SMILES for methyl 5-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)pyridine-2-carboxylate;hydrochloride is COC(=O)c1ccc(C2CC3(CCN2)CC(F)(F)C3)cn1.Cl.
What is the InChIKey of methyl 5-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)pyridine-2-carboxylate;hydrochloride?
The InChIKey is NNTWLNWUAGMEGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F2N2O2.ClH/c1-21-13(20)11-3-2-10(7-19-11)12-6-14(4-5-18-12)8-15(16,17)9-14;/h2-3,7,12,18H,4-6,8-9H2,1H3;1H.
What are the key properties of methyl 5-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)pyridine-2-carboxylate;hydrochloride?
methyl 5-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)pyridine-2-carboxylate;hydrochloride has a molecular weight of 332.78 g/mol, XLogP of 3.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)pyridine-2-carboxylate;hydrochloride is sourced from PubChem (CID 170975594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).