C30H44N2O7U — CID 170976076
acetic acid;8-[2-[2-(4-ethylpiperazin-1-yl)ethoxy]ethoxy]-4-hydroxy-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.5]dec-3-en-2-one;uranium(2+) (PubChem CID 170976076) has the molecular formula C30H44N2O7U and a molecular weight of 782.72 g/mol. Its IUPAC name is acetic acid;8-[2-[2-(4-ethylpiperazin-1-yl)ethoxy]ethoxy]-4-hydroxy-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.5]dec-3-en-2-one;uranium(2+).
| Compound Name | acetic acid;8-[2-[2-(4-ethylpiperazin-1-yl)ethoxy]ethoxy]-4-hydroxy-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.5]dec-3-en-2-one;uranium(2+) |
|---|---|
| PubChem CID | 170976076 |
| Molecular Formula | C30H44N2O7U |
| Molecular Weight | 782.72 g/mol |
| Exact Mass | 782.37 |
| IUPAC Name | acetic acid;8-[2-[2-(4-ethylpiperazin-1-yl)ethoxy]ethoxy]-4-hydroxy-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.5]dec-3-en-2-one;uranium(2+) |
| SMILES | [CH2-]C(=O)O.[CH2-]CN1CCN(CCOCCOC2CCC3(CC2)OC(=O)C(c2c(C)cc(C)cc2C)=C3O)CC1.[U+2] |
| InChI | InChI=1S/C28H41N2O5.C2H3O2.U/c1-5-29-10-12-30(13-11-29)14-15-33-16-17-34-23-6-8-28(9-7-23)26(31)25(27(32)35-28)24-21(3)18-20(2)19-22(24)4;1-2(3)4;/h18-19,23,31H,1,5-17H2,2-4H3;1H2,(H,3,4);/q2*-1;+2 |
| InChIKey | SZUXJYZXVXDMHP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.72 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|