C14H17NO2 — CID 17097627
N-[4-(2-methylprop-2-enoxy)phenyl]cyclopropanecarboxamide (PubChem CID 17097627) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is N-[4-(2-methylprop-2-enoxy)phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-(2-methylprop-2-enoxy)phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 17097627 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | N-[4-(2-methylprop-2-enoxy)phenyl]cyclopropanecarboxamide |
| SMILES | C=C(C)COc1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C14H17NO2/c1-10(2)9-17-13-7-5-12(6-8-13)15-14(16)11-3-4-11/h5-8,11H,1,3-4,9H2,2H3,(H,15,16) |
| InChIKey | AWIXLQQTXUFAOM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|