C34H56N2O10 — CID 170976297
(E)-3-cyclohexyl-3-hydroxy-2-(2,4,6-trimethylphenyl)prop-2-enoic acid;2-[2-[2-[2-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 170976297) has the molecular formula C34H56N2O10 and a molecular weight of 652.83 g/mol. Its IUPAC name is (E)-3-cyclohexyl-3-hydroxy-2-(2,4,6-trimethylphenyl)prop-2-enoic acid;2-[2-[2-[2-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | (E)-3-cyclohexyl-3-hydroxy-2-(2,4,6-trimethylphenyl)prop-2-enoic acid;2-[2-[2-[2-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 170976297 |
| Molecular Formula | C34H56N2O10 |
| Molecular Weight | 652.83 g/mol |
| Exact Mass | 652.39 |
| IUPAC Name | (E)-3-cyclohexyl-3-hydroxy-2-(2,4,6-trimethylphenyl)prop-2-enoic acid;2-[2-[2-[2-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | Cc1cc(C)c(/C(C(=O)O)=C(\O)C2CCCCC2)c(C)c1.O=C(O)COCCOCCOCCN1CCN(CCOCCO)CC1 |
| InChI | InChI=1S/C18H24O3.C16H32N2O7/c1-11-9-12(2)15(13(3)10-11)16(18(20)21)17(19)14-7-5-4-6-8-14;19-7-10-22-8-5-17-1-3-18(4-2-17)6-9-23-11-12-24-13-14-25-15-16(20)21/h9-10,14,19H,4-8H2,1-3H3,(H,20,21);19H,1-15H2,(H,20,21)/b17-16+; |
| InChIKey | KHJHJPZQTZZUQJ-CMBBICFISA-N |
| XLogP | 3.29 |
| TPSA | 158.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.83 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|