C33H44O9 — CID 170976391
(E)-3-[4-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethoxy]cyclohexyl]-3-phenylmethoxy-2-(2,4,6-trimethylphenyl)prop-2-enoic acid (PubChem CID 170976391) has the molecular formula C33H44O9 and a molecular weight of 584.71 g/mol. Its IUPAC name is (E)-3-[4-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethoxy]cyclohexyl]-3-phenylmethoxy-2-(2,4,6-trimethylphenyl)prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethoxy]cyclohexyl]-3-phenylmethoxy-2-(2,4,6-trimethylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 170976391 |
| Molecular Formula | C33H44O9 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | (E)-3-[4-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethoxy]cyclohexyl]-3-phenylmethoxy-2-(2,4,6-trimethylphenyl)prop-2-enoic acid |
| SMILES | Cc1cc(C)c(/C(C(=O)O)=C(\OCc2ccccc2)C2CCC(OCCOCCOCCOCC(=O)O)CC2)c(C)c1 |
| InChI | InChI=1S/C33H44O9/c1-23-19-24(2)30(25(3)20-23)31(33(36)37)32(42-21-26-7-5-4-6-8-26)27-9-11-28(12-10-27)41-18-17-39-14-13-38-15-16-40-22-29(34)35/h4-8,19-20,27-28H,9-18,21-22H2,1-3H3,(H,34,35)(H,36,37)/b32-31+ |
| InChIKey | PYOZAKPUXXYWGI-QNEJGDQOSA-N |
| XLogP | 5.33 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|