About 3-[3-(3-cyclobutyloxy-2,2-difluoropropoxy)propoxy]-1-methylazetidine
3-[3-(3-cyclobutyloxy-2,2-difluoropropoxy)propoxy]-1-methylazetidine (PubChem CID 170976400) has the molecular formula C14H25F2NO3
and a molecular weight of 293.35 g/mol. Its IUPAC name is 3-[3-(3-cyclobutyloxy-2,2-difluoropropoxy)propoxy]-1-methylazetidine.
Molecular Properties
| Compound Name | 3-[3-(3-cyclobutyloxy-2,2-difluoropropoxy)propoxy]-1-methylazetidine |
| PubChem CID | 170976400 |
| Molecular Formula | C14H25F2NO3 |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 3-[3-(3-cyclobutyloxy-2,2-difluoropropoxy)propoxy]-1-methylazetidine |
| SMILES | CN1CC(OCCCOCC(F)(F)COC2CCC2)C1 |
| InChI | InChI=1S/C14H25F2NO3/c1-17-8-13(9-17)19-7-3-6-18-10-14(15,16)11-20-12-4-2-5-12/h12-13H,2-11H2,1H3 |
| InChIKey | SPOQTVZOBPZZIX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(3-cyclobutyloxy-2,2-difluoropropoxy)propoxy]-1-methylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(3-cyclobutyloxy-2,2-difluoropropoxy)propoxy]-1-methylazetidine?
The IUPAC name of 3-[3-(3-cyclobutyloxy-2,2-difluoropropoxy)propoxy]-1-methylazetidine (CID 170976400) is 3-[3-(3-cyclobutyloxy-2,2-difluoropropoxy)propoxy]-1-methylazetidine.
What is the SMILES notation for 3-[3-(3-cyclobutyloxy-2,2-difluoropropoxy)propoxy]-1-methylazetidine?
The canonical SMILES for 3-[3-(3-cyclobutyloxy-2,2-difluoropropoxy)propoxy]-1-methylazetidine is CN1CC(OCCCOCC(F)(F)COC2CCC2)C1.
What is the InChIKey of 3-[3-(3-cyclobutyloxy-2,2-difluoropropoxy)propoxy]-1-methylazetidine?
The InChIKey is SPOQTVZOBPZZIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25F2NO3/c1-17-8-13(9-17)19-7-3-6-18-10-14(15,16)11-20-12-4-2-5-12/h12-13H,2-11H2,1H3.
What are the key properties of 3-[3-(3-cyclobutyloxy-2,2-difluoropropoxy)propoxy]-1-methylazetidine?
3-[3-(3-cyclobutyloxy-2,2-difluoropropoxy)propoxy]-1-methylazetidine has a molecular weight of 293.35 g/mol, XLogP of 1.93, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(3-cyclobutyloxy-2,2-difluoropropoxy)propoxy]-1-methylazetidine is sourced from PubChem (CID 170976400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).