About trans-(1R,2R)-2-(2-methoxyethoxy)-N-methylcyclobutan-1-amine
trans-(1R,2R)-2-(2-methoxyethoxy)-N-methylcyclobutan-1-amine (PubChem CID 170976575) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is trans-(1R,2R)-2-(2-methoxyethoxy)-N-methylcyclobutan-1-amine.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-(2-methoxyethoxy)-N-methylcyclobutan-1-amine |
| PubChem CID | 170976575 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | trans-(1R,2R)-2-(2-methoxyethoxy)-N-methylcyclobutan-1-amine |
| SMILES | CN[C@@H]1CC[C@H]1OCCOC |
| InChI | InChI=1S/C8H17NO2/c1-9-7-3-4-8(7)11-6-5-10-2/h7-9H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | QXORCKIEMJQWDT-HTQZYQBOSA-N |
| XLogP | 0.40 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2R)-2-(2-methoxyethoxy)-N-methylcyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-(2-methoxyethoxy)-N-methylcyclobutan-1-amine?
The IUPAC name of trans-(1R,2R)-2-(2-methoxyethoxy)-N-methylcyclobutan-1-amine (CID 170976575) is trans-(1R,2R)-2-(2-methoxyethoxy)-N-methylcyclobutan-1-amine.
What is the SMILES notation for trans-(1R,2R)-2-(2-methoxyethoxy)-N-methylcyclobutan-1-amine?
The canonical SMILES for trans-(1R,2R)-2-(2-methoxyethoxy)-N-methylcyclobutan-1-amine is CN[C@@H]1CC[C@H]1OCCOC.
What is the InChIKey of trans-(1R,2R)-2-(2-methoxyethoxy)-N-methylcyclobutan-1-amine?
The InChIKey is QXORCKIEMJQWDT-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H17NO2/c1-9-7-3-4-8(7)11-6-5-10-2/h7-9H,3-6H2,1-2H3/t7-,8-/m1/s1.
What are the key properties of trans-(1R,2R)-2-(2-methoxyethoxy)-N-methylcyclobutan-1-amine?
trans-(1R,2R)-2-(2-methoxyethoxy)-N-methylcyclobutan-1-amine has a molecular weight of 159.23 g/mol, XLogP of 0.40, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-(2-methoxyethoxy)-N-methylcyclobutan-1-amine is sourced from PubChem (CID 170976575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).