C35H57N3O9 — CID 170976649
(E)-4-cyclohexyl-4-hydroxy-3-(2,4,6-trimethylphenyl)but-3-en-2-one;2-[2-[2-[2-[4-[2-(2-nitrosoethoxy)ethyl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 170976649) has the molecular formula C35H57N3O9 and a molecular weight of 663.85 g/mol. Its IUPAC name is (E)-4-cyclohexyl-4-hydroxy-3-(2,4,6-trimethylphenyl)but-3-en-2-one;2-[2-[2-[2-[4-[2-(2-nitrosoethoxy)ethyl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | (E)-4-cyclohexyl-4-hydroxy-3-(2,4,6-trimethylphenyl)but-3-en-2-one;2-[2-[2-[2-[4-[2-(2-nitrosoethoxy)ethyl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 170976649 |
| Molecular Formula | C35H57N3O9 |
| Molecular Weight | 663.85 g/mol |
| Exact Mass | 663.41 |
| IUPAC Name | (E)-4-cyclohexyl-4-hydroxy-3-(2,4,6-trimethylphenyl)but-3-en-2-one;2-[2-[2-[2-[4-[2-(2-nitrosoethoxy)ethyl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | CC(=O)/C(=C(/O)C1CCCCC1)c1c(C)cc(C)cc1C.O=NCCOCCN1CCN(CCOCCOCCOCC(=O)O)CC1 |
| InChI | InChI=1S/C19H26O2.C16H31N3O7/c1-12-10-13(2)17(14(3)11-12)18(15(4)20)19(21)16-8-6-5-7-9-16;20-16(21)15-26-14-13-25-12-11-24-10-7-19-4-2-18(3-5-19)6-9-23-8-1-17-22/h10-11,16,21H,5-9H2,1-4H3;1-15H2,(H,20,21)/b19-18-; |
| InChIKey | GLJQPPMOKVNPNO-TVWXOORISA-N |
| XLogP | 4.57 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.85 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|