About 8-(1,1-dioxothian-4-ylidene)octanal
8-(1,1-dioxothian-4-ylidene)octanal (PubChem CID 170976764) has the molecular formula C13H22O3S
and a molecular weight of 258.38 g/mol. Its IUPAC name is 8-(1,1-dioxothian-4-ylidene)octanal.
Molecular Properties
| Compound Name | 8-(1,1-dioxothian-4-ylidene)octanal |
| PubChem CID | 170976764 |
| Molecular Formula | C13H22O3S |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 8-(1,1-dioxothian-4-ylidene)octanal |
| SMILES | O=CCCCCCCC=C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H22O3S/c14-10-6-4-2-1-3-5-7-13-8-11-17(15,16)12-9-13/h7,10H,1-6,8-9,11-12H2 |
| InChIKey | IAEJFLCKZSRULZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-(1,1-dioxothian-4-ylidene)octanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1,1-dioxothian-4-ylidene)octanal?
The IUPAC name of 8-(1,1-dioxothian-4-ylidene)octanal (CID 170976764) is 8-(1,1-dioxothian-4-ylidene)octanal.
What is the SMILES notation for 8-(1,1-dioxothian-4-ylidene)octanal?
The canonical SMILES for 8-(1,1-dioxothian-4-ylidene)octanal is O=CCCCCCCC=C1CCS(=O)(=O)CC1.
What is the InChIKey of 8-(1,1-dioxothian-4-ylidene)octanal?
The InChIKey is IAEJFLCKZSRULZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O3S/c14-10-6-4-2-1-3-5-7-13-8-11-17(15,16)12-9-13/h7,10H,1-6,8-9,11-12H2.
What are the key properties of 8-(1,1-dioxothian-4-ylidene)octanal?
8-(1,1-dioxothian-4-ylidene)octanal has a molecular weight of 258.38 g/mol, XLogP of 2.66, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1,1-dioxothian-4-ylidene)octanal is sourced from PubChem (CID 170976764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).