C19H20N4O2S — CID 170976851
3-[(4-ethoxyphenyl)sulfanylamino]-N-(1-methylpyrazol-4-yl)benzamide (PubChem CID 170976851) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 3-[(4-ethoxyphenyl)sulfanylamino]-N-(1-methylpyrazol-4-yl)benzamide.
| Compound Name | 3-[(4-ethoxyphenyl)sulfanylamino]-N-(1-methylpyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 170976851 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 3-[(4-ethoxyphenyl)sulfanylamino]-N-(1-methylpyrazol-4-yl)benzamide |
| SMILES | CCOc1ccc(SNc2cccc(C(=O)Nc3cnn(C)c3)c2)cc1 |
| InChI | InChI=1S/C19H20N4O2S/c1-3-25-17-7-9-18(10-8-17)26-22-15-6-4-5-14(11-15)19(24)21-16-12-20-23(2)13-16/h4-13,22H,3H2,1-2H3,(H,21,24) |
| InChIKey | QYUGCJMNLSMFFI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|