C21H19FN2OS — CID 170976993
N-(2,4-dimethylphenyl)-4-[(4-fluorophenyl)sulfanylamino]benzamide (PubChem CID 170976993) has the molecular formula C21H19FN2OS and a molecular weight of 366.46 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-[(4-fluorophenyl)sulfanylamino]benzamide.
| Compound Name | N-(2,4-dimethylphenyl)-4-[(4-fluorophenyl)sulfanylamino]benzamide |
|---|---|
| PubChem CID | 170976993 |
| Molecular Formula | C21H19FN2OS |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-[(4-fluorophenyl)sulfanylamino]benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(NSc3ccc(F)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C21H19FN2OS/c1-14-3-12-20(15(2)13-14)23-21(25)16-4-8-18(9-5-16)24-26-19-10-6-17(22)7-11-19/h3-13,24H,1-2H3,(H,23,25) |
| InChIKey | OFYLZLUFUONYEG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|