C23H20F3N5O3 — CID 170977668
(3-phenyl-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-yl)-[(7R)-2-(trifluoromethyl)spiro[6H-furo[2,3-b]pyrazine-7,2'-pyrrolidine]-1'-yl]methanone (PubChem CID 170977668) has the molecular formula C23H20F3N5O3 and a molecular weight of 471.44 g/mol. Its IUPAC name is (3-phenyl-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-yl)-[(7R)-2-(trifluoromethyl)spiro[6H-furo[2,3-b]pyrazine-7,2'-pyrrolidine]-1'-yl]methanone.
| Compound Name | (3-phenyl-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-yl)-[(7R)-2-(trifluoromethyl)spiro[6H-furo[2,3-b]pyrazine-7,2'-pyrrolidine]-1'-yl]methanone |
|---|---|
| PubChem CID | 170977668 |
| Molecular Formula | C23H20F3N5O3 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | (3-phenyl-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-yl)-[(7R)-2-(trifluoromethyl)spiro[6H-furo[2,3-b]pyrazine-7,2'-pyrrolidine]-1'-yl]methanone |
| SMILES | O=C(c1nn2c(c1-c1ccccc1)COCC2)N1CCC[C@@]12COc1ncc(C(F)(F)F)nc12 |
| InChI | InChI=1S/C23H20F3N5O3/c24-23(25,26)16-11-27-20-19(28-16)22(13-34-20)7-4-8-30(22)21(32)18-17(14-5-2-1-3-6-14)15-12-33-10-9-31(15)29-18/h1-3,5-6,11H,4,7-10,12-13H2/t22-/m0/s1 |
| InChIKey | ZMXMOVJFHGTDEE-QFIPXVFZSA-N |
| XLogP | 3.41 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |