About buta-1,3-diene;ethyl 5-bromo-1,2-dimethylimidazole-4-carboxylate
buta-1,3-diene;ethyl 5-bromo-1,2-dimethylimidazole-4-carboxylate (PubChem CID 170977740) has the molecular formula C12H17BrN2O2
and a molecular weight of 301.18 g/mol. Its IUPAC name is buta-1,3-diene;ethyl 5-bromo-1,2-dimethylimidazole-4-carboxylate.
Molecular Properties
| Compound Name | buta-1,3-diene;ethyl 5-bromo-1,2-dimethylimidazole-4-carboxylate |
| PubChem CID | 170977740 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | buta-1,3-diene;ethyl 5-bromo-1,2-dimethylimidazole-4-carboxylate |
| SMILES | C=CC=C.CCOC(=O)c1nc(C)n(C)c1Br |
| InChI | InChI=1S/C8H11BrN2O2.C4H6/c1-4-13-8(12)6-7(9)11(3)5(2)10-6;1-3-4-2/h4H2,1-3H3;3-4H,1-2H2 |
| InChIKey | DUDUJHMSDNMCRC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-diene;ethyl 5-bromo-1,2-dimethylimidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-diene;ethyl 5-bromo-1,2-dimethylimidazole-4-carboxylate?
The IUPAC name of buta-1,3-diene;ethyl 5-bromo-1,2-dimethylimidazole-4-carboxylate (CID 170977740) is buta-1,3-diene;ethyl 5-bromo-1,2-dimethylimidazole-4-carboxylate.
What is the SMILES notation for buta-1,3-diene;ethyl 5-bromo-1,2-dimethylimidazole-4-carboxylate?
The canonical SMILES for buta-1,3-diene;ethyl 5-bromo-1,2-dimethylimidazole-4-carboxylate is C=CC=C.CCOC(=O)c1nc(C)n(C)c1Br.
What is the InChIKey of buta-1,3-diene;ethyl 5-bromo-1,2-dimethylimidazole-4-carboxylate?
The InChIKey is DUDUJHMSDNMCRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrN2O2.C4H6/c1-4-13-8(12)6-7(9)11(3)5(2)10-6;1-3-4-2/h4H2,1-3H3;3-4H,1-2H2.
What are the key properties of buta-1,3-diene;ethyl 5-bromo-1,2-dimethylimidazole-4-carboxylate?
buta-1,3-diene;ethyl 5-bromo-1,2-dimethylimidazole-4-carboxylate has a molecular weight of 301.18 g/mol, XLogP of 3.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diene;ethyl 5-bromo-1,2-dimethylimidazole-4-carboxylate is sourced from PubChem (CID 170977740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).