C33H40BrN7O3 — CID 170978346
3-[4-[4-[[4-[5-[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]-1-methylpiperidin-3-yl]phenyl]methyl]piperazin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 170978346) has the molecular formula C33H40BrN7O3 and a molecular weight of 662.63 g/mol. Its IUPAC name is 3-[4-[4-[[4-[5-[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]-1-methylpiperidin-3-yl]phenyl]methyl]piperazin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[[4-[5-[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]-1-methylpiperidin-3-yl]phenyl]methyl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170978346 |
| Molecular Formula | C33H40BrN7O3 |
| Molecular Weight | 662.63 g/mol |
| Exact Mass | 661.24 |
| IUPAC Name | 3-[4-[4-[[4-[5-[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]-1-methylpiperidin-3-yl]phenyl]methyl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | CN1CC(Nc2cnn(C)c(=O)c2Br)CC(c2ccc(CN3CCN(c4ccc(C5CCC(=O)NC5=O)cc4)CC3)cc2)C1 |
| InChI | InChI=1S/C33H40BrN7O3/c1-38-20-25(17-26(21-38)36-29-18-35-39(2)33(44)31(29)34)23-5-3-22(4-6-23)19-40-13-15-41(16-14-40)27-9-7-24(8-10-27)28-11-12-30(42)37-32(28)43/h3-10,18,25-26,28,36H,11-17,19-21H2,1-2H3,(H,37,42,43) |
| InChIKey | OERYFYWSBJECNA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.63 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|