C16H26N2O2S — CID 170978699
1-[4-[(4-propan-2-yloxyphenyl)methyl]piperazin-1-yl]ethanone;sulfane (PubChem CID 170978699) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is 1-[4-[(4-propan-2-yloxyphenyl)methyl]piperazin-1-yl]ethanone;sulfane.
| Compound Name | 1-[4-[(4-propan-2-yloxyphenyl)methyl]piperazin-1-yl]ethanone;sulfane |
|---|---|
| PubChem CID | 170978699 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-[4-[(4-propan-2-yloxyphenyl)methyl]piperazin-1-yl]ethanone;sulfane |
| SMILES | CC(=O)N1CCN(Cc2ccc(OC(C)C)cc2)CC1.S |
| InChI | InChI=1S/C16H24N2O2.H2S/c1-13(2)20-16-6-4-15(5-7-16)12-17-8-10-18(11-9-17)14(3)19;/h4-7,13H,8-12H2,1-3H3;1H2 |
| InChIKey | KYMQNUWKRYFLAN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |