C26H40N2O5 — CID 17097880
decyl 2-[1-[2-(2,3-dimethylphenoxy)acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17097880) has the molecular formula C26H40N2O5 and a molecular weight of 460.62 g/mol. Its IUPAC name is decyl 2-[1-[2-(2,3-dimethylphenoxy)acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | decyl 2-[1-[2-(2,3-dimethylphenoxy)acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17097880 |
| Molecular Formula | C26H40N2O5 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | decyl 2-[1-[2-(2,3-dimethylphenoxy)acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=O)COc1cccc(C)c1C |
| InChI | InChI=1S/C26H40N2O5/c1-4-5-6-7-8-9-10-11-17-32-25(30)18-22-26(31)27-15-16-28(22)24(29)19-33-23-14-12-13-20(2)21(23)3/h12-14,22H,4-11,15-19H2,1-3H3,(H,27,31) |
| InChIKey | UXWUJAJQUHBBKB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|