C9H17N3O2 — CID 170980144
ethane;6-ethyl-2,4-dimethyl-1,2,4-triazine-3,5-dione (PubChem CID 170980144) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is ethane;6-ethyl-2,4-dimethyl-1,2,4-triazine-3,5-dione.
| Compound Name | ethane;6-ethyl-2,4-dimethyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 170980144 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | ethane;6-ethyl-2,4-dimethyl-1,2,4-triazine-3,5-dione |
| SMILES | CC.CCc1nn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C7H11N3O2.C2H6/c1-4-5-6(11)9(2)7(12)10(3)8-5;1-2/h4H2,1-3H3;1-2H3 |
| InChIKey | XEMDSHXZFITPSO-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |