C19H21BrN4O2 — CID 170980450
5-bromo-3-[C-ethyl-N-[1-(oxan-4-yl)pyrazol-4-yl]carbonimidoyl]-1H-indol-2-ol (PubChem CID 170980450) has the molecular formula C19H21BrN4O2 and a molecular weight of 417.31 g/mol. Its IUPAC name is 5-bromo-3-[C-ethyl-N-[1-(oxan-4-yl)pyrazol-4-yl]carbonimidoyl]-1H-indol-2-ol.
| Compound Name | 5-bromo-3-[C-ethyl-N-[1-(oxan-4-yl)pyrazol-4-yl]carbonimidoyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 170980450 |
| Molecular Formula | C19H21BrN4O2 |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 5-bromo-3-[C-ethyl-N-[1-(oxan-4-yl)pyrazol-4-yl]carbonimidoyl]-1H-indol-2-ol |
| SMILES | CC/C(=N\c1cnn(C2CCOCC2)c1)c1c(O)[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C19H21BrN4O2/c1-2-16(18-15-9-12(20)3-4-17(15)23-19(18)25)22-13-10-21-24(11-13)14-5-7-26-8-6-14/h3-4,9-11,14,23,25H,2,5-8H2,1H3/b22-16+ |
| InChIKey | UXNFZGHCIPFBLZ-CJLVFECKSA-N |
| XLogP | 4.71 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|