C10H14N2OS — CID 170981035
3,6-diethyl-1,4-dihydrothieno[3,2-d]pyrimidin-2-one (PubChem CID 170981035) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 3,6-diethyl-1,4-dihydrothieno[3,2-d]pyrimidin-2-one.
| Compound Name | 3,6-diethyl-1,4-dihydrothieno[3,2-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 170981035 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 3,6-diethyl-1,4-dihydrothieno[3,2-d]pyrimidin-2-one |
| SMILES | CCc1cc2c(s1)CN(CC)C(=O)N2 |
| InChI | InChI=1S/C10H14N2OS/c1-3-7-5-8-9(14-7)6-12(4-2)10(13)11-8/h5H,3-4,6H2,1-2H3,(H,11,13) |
| InChIKey | WSFVPASQEQXGBZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |