C24H28N6O2S — CID 170981564
5-[4-[(3-cyclobutyl-2-oxo-4-sulfanylidene-1H-quinazolin-7-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide (PubChem CID 170981564) has the molecular formula C24H28N6O2S and a molecular weight of 464.60 g/mol. Its IUPAC name is 5-[4-[(3-cyclobutyl-2-oxo-4-sulfanylidene-1H-quinazolin-7-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[4-[(3-cyclobutyl-2-oxo-4-sulfanylidene-1H-quinazolin-7-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 170981564 |
| Molecular Formula | C24H28N6O2S |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 5-[4-[(3-cyclobutyl-2-oxo-4-sulfanylidene-1H-quinazolin-7-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCN(Cc3ccc4c(=S)n(C5CCC5)c(=O)[nH]c4c3)CC2)cn1 |
| InChI | InChI=1S/C24H28N6O2S/c1-25-22(31)20-8-6-18(14-26-20)29-11-9-28(10-12-29)15-16-5-7-19-21(13-16)27-24(32)30(23(19)33)17-3-2-4-17/h5-8,13-14,17H,2-4,9-12,15H2,1H3,(H,25,31)(H,27,32) |
| InChIKey | WHRHLCBWMIDREQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 86.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|