About 5-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)pentan-1-ol
5-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)pentan-1-ol (PubChem CID 170981972) has the molecular formula C17H22N2O2
and a molecular weight of 286.38 g/mol. Its IUPAC name is 5-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)pentan-1-ol.
Molecular Properties
| Compound Name | 5-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)pentan-1-ol |
| PubChem CID | 170981972 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 5-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)pentan-1-ol |
| SMILES | COc1ccc2c3c([nH]c2c1)C(CCCCCO)=NCC3 |
| InChI | InChI=1S/C17H22N2O2/c1-21-12-6-7-13-14-8-9-18-15(5-3-2-4-10-20)17(14)19-16(13)11-12/h6-7,11,19-20H,2-5,8-10H2,1H3 |
| InChIKey | DWGDSUIGGVBCDJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)pentan-1-ol?
The IUPAC name of 5-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)pentan-1-ol (CID 170981972) is 5-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)pentan-1-ol.
What is the SMILES notation for 5-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)pentan-1-ol?
The canonical SMILES for 5-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)pentan-1-ol is COc1ccc2c3c([nH]c2c1)C(CCCCCO)=NCC3.
What is the InChIKey of 5-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)pentan-1-ol?
The InChIKey is DWGDSUIGGVBCDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2/c1-21-12-6-7-13-14-8-9-18-15(5-3-2-4-10-20)17(14)19-16(13)11-12/h6-7,11,19-20H,2-5,8-10H2,1H3.
What are the key properties of 5-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)pentan-1-ol?
5-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)pentan-1-ol has a molecular weight of 286.38 g/mol, XLogP of 3.07, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)pentan-1-ol is sourced from PubChem (CID 170981972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).