About 7-bromo-9-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one
7-bromo-9-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one (PubChem CID 170982011) has the molecular formula C10H10BrNO3
and a molecular weight of 272.10 g/mol. Its IUPAC name is 7-bromo-9-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
Molecular Properties
| Compound Name | 7-bromo-9-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| PubChem CID | 170982011 |
| Molecular Formula | C10H10BrNO3 |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 7-bromo-9-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| SMILES | COc1cc(Br)cc2c1OCCNC2=O |
| InChI | InChI=1S/C10H10BrNO3/c1-14-8-5-6(11)4-7-9(8)15-3-2-12-10(7)13/h4-5H,2-3H2,1H3,(H,12,13) |
| InChIKey | KOPHMYCENHNHNW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-9-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-9-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
The IUPAC name of 7-bromo-9-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one (CID 170982011) is 7-bromo-9-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
What is the SMILES notation for 7-bromo-9-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
The canonical SMILES for 7-bromo-9-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one is COc1cc(Br)cc2c1OCCNC2=O.
What is the InChIKey of 7-bromo-9-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
The InChIKey is KOPHMYCENHNHNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNO3/c1-14-8-5-6(11)4-7-9(8)15-3-2-12-10(7)13/h4-5H,2-3H2,1H3,(H,12,13).
What are the key properties of 7-bromo-9-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
7-bromo-9-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one has a molecular weight of 272.10 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-9-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one is sourced from PubChem (CID 170982011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).