C22H40N4O4 — CID 170982029
[1-[2-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxyethyl]-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-6-yl] N-ethylcarbamate (PubChem CID 170982029) has the molecular formula C22H40N4O4 and a molecular weight of 424.59 g/mol. Its IUPAC name is [1-[2-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxyethyl]-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-6-yl] N-ethylcarbamate.
| Compound Name | [1-[2-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxyethyl]-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-6-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 170982029 |
| Molecular Formula | C22H40N4O4 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | [1-[2-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxyethyl]-4,5,6,7,8,9-hexahydrocycloocta[d]triazol-6-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)OC1CCCc2c(nnn2CCOC(C)(C)CCOC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H40N4O4/c1-7-23-20(27)30-17-9-8-10-19-18(12-11-17)24-25-26(19)14-16-29-22(5,6)13-15-28-21(2,3)4/h17H,7-16H2,1-6H3,(H,23,27) |
| InChIKey | BBPVGUMHFVIJGN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |