C23H23N3O5 — CID 170982050
6,8-bis(3,5-dimethyl-1,2-oxazol-4-yl)-2-morpholin-4-ylchromen-4-one (PubChem CID 170982050) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is 6,8-bis(3,5-dimethyl-1,2-oxazol-4-yl)-2-morpholin-4-ylchromen-4-one.
| Compound Name | 6,8-bis(3,5-dimethyl-1,2-oxazol-4-yl)-2-morpholin-4-ylchromen-4-one |
|---|---|
| PubChem CID | 170982050 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 6,8-bis(3,5-dimethyl-1,2-oxazol-4-yl)-2-morpholin-4-ylchromen-4-one |
| SMILES | Cc1noc(C)c1-c1cc(-c2c(C)noc2C)c2oc(N3CCOCC3)cc(=O)c2c1 |
| InChI | InChI=1S/C23H23N3O5/c1-12-21(14(3)30-24-12)16-9-17-19(27)11-20(26-5-7-28-8-6-26)29-23(17)18(10-16)22-13(2)25-31-15(22)4/h9-11H,5-8H2,1-4H3 |
| InChIKey | GKHUYJAQGRPIMF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 94.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |