C26H33N3O2S — CID 170982133
1,2,4-trimethyl-7-(9-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)phenothiazin-3-one (PubChem CID 170982133) has the molecular formula C26H33N3O2S and a molecular weight of 451.64 g/mol. Its IUPAC name is 1,2,4-trimethyl-7-(9-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)phenothiazin-3-one.
| Compound Name | 1,2,4-trimethyl-7-(9-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)phenothiazin-3-one |
|---|---|
| PubChem CID | 170982133 |
| Molecular Formula | C26H33N3O2S |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 1,2,4-trimethyl-7-(9-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)phenothiazin-3-one |
| SMILES | Cc1c2nc3ccc(N4CCOC5(CCN(C(C)C)CC5)C4)cc3sc-2c(C)c(=O)c1C |
| InChI | InChI=1S/C26H33N3O2S/c1-16(2)28-10-8-26(9-11-28)15-29(12-13-31-26)20-6-7-21-22(14-20)32-25-19(5)24(30)18(4)17(3)23(25)27-21/h6-7,14,16H,8-13,15H2,1-5H3 |
| InChIKey | RLSUEZIWDJSNMO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|