C21H32O3 — CID 170982241
(3R,10R,11S,13R)-13-hydroxy-14-(methoxymethyl)-3,10-dimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),6-dien-9-one (PubChem CID 170982241) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (3R,10R,11S,13R)-13-hydroxy-14-(methoxymethyl)-3,10-dimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),6-dien-9-one.
| Compound Name | (3R,10R,11S,13R)-13-hydroxy-14-(methoxymethyl)-3,10-dimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),6-dien-9-one |
|---|---|
| PubChem CID | 170982241 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (3R,10R,11S,13R)-13-hydroxy-14-(methoxymethyl)-3,10-dimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),6-dien-9-one |
| SMILES | COCC1=C2C[C@@]3(C)CCC(C(C)C)=C3CC(=O)[C@H](C)[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C21H32O3/c1-12(2)14-6-7-21(4)10-16-15(8-20(23)17(16)11-24-5)13(3)19(22)9-18(14)21/h12-13,15,20,23H,6-11H2,1-5H3/t13-,15+,20-,21-/m1/s1 |
| InChIKey | AWLHXOIDSWBDTB-NEGFDYCVSA-N |
| XLogP | 4.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|