C25H34F3N3O6 — CID 170982644
(2R,3R,4R,5R,6R)-3-benzyl-2-tert-butyl-2-(hydroxymethyl)-6-(2-methoxyethoxy)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 170982644) has the molecular formula C25H34F3N3O6 and a molecular weight of 529.56 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-3-benzyl-2-tert-butyl-2-(hydroxymethyl)-6-(2-methoxyethoxy)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6R)-3-benzyl-2-tert-butyl-2-(hydroxymethyl)-6-(2-methoxyethoxy)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 170982644 |
| Molecular Formula | C25H34F3N3O6 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | (2R,3R,4R,5R,6R)-3-benzyl-2-tert-butyl-2-(hydroxymethyl)-6-(2-methoxyethoxy)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | COCCO[C@@H]1O[C@@](CO)(C(C)(C)C)[C@@](O)(Cc2ccccc2)[C@H](O)[C@H]1Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C25H34F3N3O6/c1-22(2,3)24(15-32)23(34,12-16-8-6-5-7-9-16)20(33)19(21(37-24)36-11-10-35-4)31-18-14-29-13-17(30-18)25(26,27)28/h5-9,13-14,19-21,32-34H,10-12,15H2,1-4H3,(H,30,31)/t19-,20-,21-,23-,24+/m1/s1 |
| InChIKey | IYEAGPBYZKXDLO-MNEQBICUSA-N |
| XLogP | 2.41 |
| TPSA | 126.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|