C14H20F3N3O6 — CID 170982656
(2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-(2-methoxyethoxy)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 170982656) has the molecular formula C14H20F3N3O6 and a molecular weight of 383.32 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-(2-methoxyethoxy)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-(2-methoxyethoxy)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 170982656 |
| Molecular Formula | C14H20F3N3O6 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-(2-methoxyethoxy)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | COCCO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H20F3N3O6/c1-24-2-3-25-13-10(12(23)11(22)7(6-21)26-13)20-9-5-18-4-8(19-9)14(15,16)17/h4-5,7,10-13,21-23H,2-3,6H2,1H3,(H,19,20)/t7-,10-,11+,12-,13-/m1/s1 |
| InChIKey | HVUKAHGDWVOHLQ-WPTBKURFSA-N |
| XLogP | -0.62 |
| TPSA | 126.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|