C25H32F3N3O5 — CID 170982669
(2R,3R,4R,5R,6S)-3-benzyl-2-tert-butyl-2-(hydroxymethyl)-6-prop-2-enoxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 170982669) has the molecular formula C25H32F3N3O5 and a molecular weight of 511.54 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-3-benzyl-2-tert-butyl-2-(hydroxymethyl)-6-prop-2-enoxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6S)-3-benzyl-2-tert-butyl-2-(hydroxymethyl)-6-prop-2-enoxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 170982669 |
| Molecular Formula | C25H32F3N3O5 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | (2R,3R,4R,5R,6S)-3-benzyl-2-tert-butyl-2-(hydroxymethyl)-6-prop-2-enoxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | C=CCO[C@H]1O[C@@](CO)(C(C)(C)C)[C@@](O)(Cc2ccccc2)[C@H](O)[C@H]1Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C25H32F3N3O5/c1-5-11-35-21-19(31-18-14-29-13-17(30-18)25(26,27)28)20(33)23(34,12-16-9-7-6-8-10-16)24(15-32,36-21)22(2,3)4/h5-10,13-14,19-21,32-34H,1,11-12,15H2,2-4H3,(H,30,31)/t19-,20-,21+,23-,24+/m1/s1 |
| InChIKey | REWGWJDAOOLAKJ-CMOSFIGNSA-N |
| XLogP | 2.95 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|