C22H35F3N4O8 — CID 170982683
N-[2-[2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 170982683) has the molecular formula C22H35F3N4O8 and a molecular weight of 540.54 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | N-[2-[2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 170982683 |
| Molecular Formula | C22H35F3N4O8 |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | N-[2-[2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CCC(=O)NCCOCCOCCOCCOC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H35F3N4O8/c1-2-19(30)27-3-4-33-5-6-34-7-8-35-9-10-36-14-16-21(32)20(31)15(13-37-16)28-18-12-26-11-17(29-18)22(23,24)25/h11-12,15-16,20-21,31-32H,2-10,13-14H2,1H3,(H,27,30)(H,28,29)/t15-,16+,20+,21-/m0/s1 |
| InChIKey | MLHMTFZQISDANE-HDIOYNLWSA-N |
| XLogP | -0.01 |
| TPSA | 153.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|