C30H36F3N3O4Si — CID 170982690
N-[(3aR,4R,7S,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 170982690) has the molecular formula C30H36F3N3O4Si and a molecular weight of 587.72 g/mol. Its IUPAC name is N-[(3aR,4R,7S,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | N-[(3aR,4R,7S,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 170982690 |
| Molecular Formula | C30H36F3N3O4Si |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | N-[(3aR,4R,7S,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Nc1cncc(C(F)(F)F)n1)CO[C@@H]2CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H36F3N3O4Si/c1-28(2,3)41(20-12-8-6-9-13-20,21-14-10-7-11-15-21)38-19-23-27-26(39-29(4,5)40-27)22(18-37-23)35-25-17-34-16-24(36-25)30(31,32)33/h6-17,22-23,26-27H,18-19H2,1-5H3,(H,35,36)/t22-,23+,26+,27-/m0/s1 |
| InChIKey | WRTZZGAOYZATSF-VBWPBTNGSA-N |
| XLogP | 4.77 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|