C18H20F3N3O6S — CID 170982712
[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 170982712) has the molecular formula C18H20F3N3O6S and a molecular weight of 463.43 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 170982712 |
| Molecular Formula | C18H20F3N3O6S |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2OC[C@H](Nc3cncc(C(F)(F)F)n3)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C18H20F3N3O6S/c1-10-2-4-11(5-3-10)31(27,28)30-9-13-17(26)16(25)12(8-29-13)23-15-7-22-6-14(24-15)18(19,20)21/h2-7,12-13,16-17,25-26H,8-9H2,1H3,(H,23,24)/t12-,13+,16+,17-/m0/s1 |
| InChIKey | PHJHAZMVKBHROP-IXKJSCDLSA-N |
| XLogP | 1.11 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|