C35H44F3N3O6Si — CID 170982731
tert-butyl N-[(3aR,4R,7S,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-N-[6-(trifluoromethyl)pyrazin-2-yl]carbamate (PubChem CID 170982731) has the molecular formula C35H44F3N3O6Si and a molecular weight of 687.83 g/mol. Its IUPAC name is tert-butyl N-[(3aR,4R,7S,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-N-[6-(trifluoromethyl)pyrazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(3aR,4R,7S,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-N-[6-(trifluoromethyl)pyrazin-2-yl]carbamate |
|---|---|
| PubChem CID | 170982731 |
| Molecular Formula | C35H44F3N3O6Si |
| Molecular Weight | 687.83 g/mol |
| Exact Mass | 687.30 |
| IUPAC Name | tert-butyl N-[(3aR,4R,7S,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-N-[6-(trifluoromethyl)pyrazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1cncc(C(F)(F)F)n1)[C@H]1CO[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C35H44F3N3O6Si/c1-32(2,3)47-31(42)41(28-20-39-19-27(40-28)35(36,37)38)25-21-43-26(30-29(25)45-34(7,8)46-30)22-44-48(33(4,5)6,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-20,25-26,29-30H,21-22H2,1-8H3/t25-,26+,29+,30-/m0/s1 |
| InChIKey | NTTDPYRENAIIPM-MDULWEFBSA-N |
| XLogP | 6.10 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.83 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|