C15H18F4N4O4 — CID 170982744
cis-(1R,2R)-N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-2-fluorocyclopropane-1-carboxamide (PubChem CID 170982744) has the molecular formula C15H18F4N4O4 and a molecular weight of 394.33 g/mol. Its IUPAC name is cis-(1R,2R)-N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-2-fluorocyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2R)-N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-2-fluorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 170982744 |
| Molecular Formula | C15H18F4N4O4 |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | cis-(1R,2R)-N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-2-fluorocyclopropane-1-carboxamide |
| SMILES | O=C(NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O)[C@H]1C[C@H]1F |
| InChI | InChI=1S/C15H18F4N4O4/c16-7-1-6(7)14(26)21-2-9-13(25)12(24)8(5-27-9)22-11-4-20-3-10(23-11)15(17,18)19/h3-4,6-9,12-13,24-25H,1-2,5H2,(H,21,26)(H,22,23)/t6-,7+,8-,9+,12+,13-/m0/s1 |
| InChIKey | RXLOMXGTTKJJGU-PGYGGGEJSA-N |
| XLogP | -0.13 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |