C27H34F3NO5Si — CID 170982746
N-[(3aR,4R,7R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-2,2,2-trifluoroacetamide (PubChem CID 170982746) has the molecular formula C27H34F3NO5Si and a molecular weight of 537.65 g/mol. Its IUPAC name is N-[(3aR,4R,7R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(3aR,4R,7R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 170982746 |
| Molecular Formula | C27H34F3NO5Si |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | N-[(3aR,4R,7R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](NC(=O)C(F)(F)F)CO[C@@H]2CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H34F3NO5Si/c1-25(2,3)37(18-12-8-6-9-13-18,19-14-10-7-11-15-19)34-17-21-23-22(35-26(4,5)36-23)20(16-33-21)31-24(32)27(28,29)30/h6-15,20-23H,16-17H2,1-5H3,(H,31,32)/t20-,21-,22-,23+/m1/s1 |
| InChIKey | JXWAJYQJVYEOJG-ODAXIHTASA-N |
| XLogP | 3.53 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|