C21H29F3N4O6 — CID 170982764
tert-butyl 3-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-3-oxopropanoate (PubChem CID 170982764) has the molecular formula C21H29F3N4O6 and a molecular weight of 490.48 g/mol. Its IUPAC name is tert-butyl 3-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-3-oxopropanoate.
| Compound Name | tert-butyl 3-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 170982764 |
| Molecular Formula | C21H29F3N4O6 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | tert-butyl 3-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-3-oxopropanoate |
| SMILES | CC(C)(C)OC(=O)CC(=O)NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C21H29F3N4O6/c1-19(2,3)32-16(30)6-15(29)26-7-12-18-17(33-20(4,5)34-18)11(10-31-12)27-14-9-25-8-13(28-14)21(22,23)24/h8-9,11-12,17-18H,6-7,10H2,1-5H3,(H,26,29)(H,27,28)/t11-,12+,17+,18-/m0/s1 |
| InChIKey | DFCJCCNOFRFWMN-MIFHMHLRSA-N |
| XLogP | 2.04 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|