C24H30F3NO5Si — CID 170982771
N-[(3R,4R,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxyoxan-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 170982771) has the molecular formula C24H30F3NO5Si and a molecular weight of 497.59 g/mol. Its IUPAC name is N-[(3R,4R,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxyoxan-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(3R,4R,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxyoxan-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 170982771 |
| Molecular Formula | C24H30F3NO5Si |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N-[(3R,4R,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxyoxan-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)(C)[Si](OC[C@H]1OC[C@@H](NC(=O)C(F)(F)F)[C@@H](O)[C@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H30F3NO5Si/c1-23(2,3)34(16-10-6-4-7-11-16,17-12-8-5-9-13-17)33-15-19-21(30)20(29)18(14-32-19)28-22(31)24(25,26)27/h4-13,18-21,29-30H,14-15H2,1-3H3,(H,28,31)/t18-,19-,20-,21+/m1/s1 |
| InChIKey | PNPZLSXQQVELKR-NCYKPQTJSA-N |
| XLogP | 1.73 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|