C21H21N3O3 — CID 170982859
2-[4-[(4-hydroxy-3-prop-2-enylphenyl)methyl]-3,5-dimethylphenyl]-1,2,4-triazine-3,5-dione (PubChem CID 170982859) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-[4-[(4-hydroxy-3-prop-2-enylphenyl)methyl]-3,5-dimethylphenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[4-[(4-hydroxy-3-prop-2-enylphenyl)methyl]-3,5-dimethylphenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 170982859 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-[4-[(4-hydroxy-3-prop-2-enylphenyl)methyl]-3,5-dimethylphenyl]-1,2,4-triazine-3,5-dione |
| SMILES | C=CCc1cc(Cc2c(C)cc(-n3ncc(=O)[nH]c3=O)cc2C)ccc1O |
| InChI | InChI=1S/C21H21N3O3/c1-4-5-16-10-15(6-7-19(16)25)11-18-13(2)8-17(9-14(18)3)24-21(27)23-20(26)12-22-24/h4,6-10,12,25H,1,5,11H2,2-3H3,(H,23,26,27) |
| InChIKey | PRVCGCJPMGAJEU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|