C27H30N6O — CID 170983312
6-[3-(azetidin-1-yl)phenyl]-5,7-dimethyl-3-(4-piperazin-1-ylphenyl)pyrrolo[3,4-d]pyridazin-4-one (PubChem CID 170983312) has the molecular formula C27H30N6O and a molecular weight of 454.58 g/mol. Its IUPAC name is 6-[3-(azetidin-1-yl)phenyl]-5,7-dimethyl-3-(4-piperazin-1-ylphenyl)pyrrolo[3,4-d]pyridazin-4-one.
| Compound Name | 6-[3-(azetidin-1-yl)phenyl]-5,7-dimethyl-3-(4-piperazin-1-ylphenyl)pyrrolo[3,4-d]pyridazin-4-one |
|---|---|
| PubChem CID | 170983312 |
| Molecular Formula | C27H30N6O |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 6-[3-(azetidin-1-yl)phenyl]-5,7-dimethyl-3-(4-piperazin-1-ylphenyl)pyrrolo[3,4-d]pyridazin-4-one |
| SMILES | Cc1c2cnn(-c3ccc(N4CCNCC4)cc3)c(=O)c2c(C)n1-c1cccc(N2CCC2)c1 |
| InChI | InChI=1S/C27H30N6O/c1-19-25-18-29-33(22-9-7-21(8-10-22)31-15-11-28-12-16-31)27(34)26(25)20(2)32(19)24-6-3-5-23(17-24)30-13-4-14-30/h3,5-10,17-18,28H,4,11-16H2,1-2H3 |
| InChIKey | NMELVTMZZPQKBD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|