C27H32F4N4O2Si — CID 170983597
4-[4-(3,3-difluoropyrrolidin-1-yl)-2,6-difluorophenyl]-3-methyl-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]azetidin-2-one (PubChem CID 170983597) has the molecular formula C27H32F4N4O2Si and a molecular weight of 548.66 g/mol. Its IUPAC name is 4-[4-(3,3-difluoropyrrolidin-1-yl)-2,6-difluorophenyl]-3-methyl-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]azetidin-2-one.
| Compound Name | 4-[4-(3,3-difluoropyrrolidin-1-yl)-2,6-difluorophenyl]-3-methyl-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]azetidin-2-one |
|---|---|
| PubChem CID | 170983597 |
| Molecular Formula | C27H32F4N4O2Si |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | 4-[4-(3,3-difluoropyrrolidin-1-yl)-2,6-difluorophenyl]-3-methyl-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]azetidin-2-one |
| SMILES | CC1C(=O)N(c2ccc3c(c2)ncn3COCC[Si](C)(C)C)C1c1c(F)cc(N2CCC(F)(F)C2)cc1F |
| InChI | InChI=1S/C27H32F4N4O2Si/c1-17-25(24-20(28)11-19(12-21(24)29)33-8-7-27(30,31)14-33)35(26(17)36)18-5-6-23-22(13-18)32-15-34(23)16-37-9-10-38(2,3)4/h5-6,11-13,15,17,25H,7-10,14,16H2,1-4H3 |
| InChIKey | LPXRUVLDHMTKQA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|