C22H15F6N3O — CID 170983780
4-[N-(2,2,2-trifluoroethyl)-3-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]anilino]-1H-quinazolin-2-one (PubChem CID 170983780) has the molecular formula C22H15F6N3O and a molecular weight of 451.37 g/mol. Its IUPAC name is 4-[N-(2,2,2-trifluoroethyl)-3-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]anilino]-1H-quinazolin-2-one.
| Compound Name | 4-[N-(2,2,2-trifluoroethyl)-3-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]anilino]-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 170983780 |
| Molecular Formula | C22H15F6N3O |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 4-[N-(2,2,2-trifluoroethyl)-3-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]anilino]-1H-quinazolin-2-one |
| SMILES | O=c1nc(N(CC(F)(F)F)c2cccc(C#CC3(C(F)(F)F)CC3)c2)c2ccccc2[nH]1 |
| InChI | InChI=1S/C22H15F6N3O/c23-21(24,25)13-31(18-16-6-1-2-7-17(16)29-19(32)30-18)15-5-3-4-14(12-15)8-9-20(10-11-20)22(26,27)28/h1-7,12H,10-11,13H2,(H,29,30,32) |
| InChIKey | JREWOAAMFPWZQN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|