C11H11BrClN3O — CID 170984065
5-amino-2-benzyl-6-bromo-4-chloro-1,2-dihydropyrazin-3-one (PubChem CID 170984065) has the molecular formula C11H11BrClN3O and a molecular weight of 316.59 g/mol. Its IUPAC name is 5-amino-2-benzyl-6-bromo-4-chloro-1,2-dihydropyrazin-3-one.
| Compound Name | 5-amino-2-benzyl-6-bromo-4-chloro-1,2-dihydropyrazin-3-one |
|---|---|
| PubChem CID | 170984065 |
| Molecular Formula | C11H11BrClN3O |
| Molecular Weight | 316.59 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | 5-amino-2-benzyl-6-bromo-4-chloro-1,2-dihydropyrazin-3-one |
| SMILES | NC1=C(Br)NC(Cc2ccccc2)C(=O)N1Cl |
| InChI | InChI=1S/C11H11BrClN3O/c12-9-10(14)16(13)11(17)8(15-9)6-7-4-2-1-3-5-7/h1-5,8,15H,6,14H2 |
| InChIKey | YVKMWPWLWSVQEU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.59 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|