C6H9FO3 — CID 170984255
(1S,2R,3S,6S)-6-fluorocyclohex-4-ene-1,2,3-triol (PubChem CID 170984255) has the molecular formula C6H9FO3 and a molecular weight of 148.13 g/mol. Its IUPAC name is (1S,2R,3S,6S)-6-fluorocyclohex-4-ene-1,2,3-triol.
| Compound Name | (1S,2R,3S,6S)-6-fluorocyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 170984255 |
| Molecular Formula | C6H9FO3 |
| Molecular Weight | 148.13 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | (1S,2R,3S,6S)-6-fluorocyclohex-4-ene-1,2,3-triol |
| SMILES | O[C@H]1[C@H](O)[C@@H](F)C=C[C@@H]1O |
| InChI | InChI=1S/C6H9FO3/c7-3-1-2-4(8)6(10)5(3)9/h1-6,8-10H/t3-,4-,5+,6+/m0/s1 |
| InChIKey | DGGHLTXNAWHUTK-UNTFVMJOSA-N |
| XLogP | -1.02 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.13 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|