C10H7FN2O3 — CID 170984863
5-fluoro-2-(3-methyl-1,2,4-oxadiazol-5-yl)benzoic acid (PubChem CID 170984863) has the molecular formula C10H7FN2O3 and a molecular weight of 222.18 g/mol. Its IUPAC name is 5-fluoro-2-(3-methyl-1,2,4-oxadiazol-5-yl)benzoic acid.
| Compound Name | 5-fluoro-2-(3-methyl-1,2,4-oxadiazol-5-yl)benzoic acid |
|---|---|
| PubChem CID | 170984863 |
| Molecular Formula | C10H7FN2O3 |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 5-fluoro-2-(3-methyl-1,2,4-oxadiazol-5-yl)benzoic acid |
| SMILES | Cc1noc(-c2ccc(F)cc2C(=O)O)n1 |
| InChI | InChI=1S/C10H7FN2O3/c1-5-12-9(16-13-5)7-3-2-6(11)4-8(7)10(14)15/h2-4H,1H3,(H,14,15) |
| InChIKey | WHHYURCROBWLTC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |