About (4-chloro-2,6-dimethylphenyl)hydrazine
(4-chloro-2,6-dimethylphenyl)hydrazine (PubChem CID 170985099) has the molecular formula C8H11ClN2
and a molecular weight of 170.64 g/mol. Its IUPAC name is (4-chloro-2,6-dimethylphenyl)hydrazine.
Molecular Properties
| Compound Name | (4-chloro-2,6-dimethylphenyl)hydrazine |
| PubChem CID | 170985099 |
| Molecular Formula | C8H11ClN2 |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (4-chloro-2,6-dimethylphenyl)hydrazine |
| SMILES | Cc1cc(Cl)cc(C)c1NN |
| InChI | InChI=1S/C8H11ClN2/c1-5-3-7(9)4-6(2)8(5)11-10/h3-4,11H,10H2,1-2H3 |
| InChIKey | UDWJARFWDHTWAW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-2,6-dimethylphenyl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-2,6-dimethylphenyl)hydrazine?
The IUPAC name of (4-chloro-2,6-dimethylphenyl)hydrazine (CID 170985099) is (4-chloro-2,6-dimethylphenyl)hydrazine.
What is the SMILES notation for (4-chloro-2,6-dimethylphenyl)hydrazine?
The canonical SMILES for (4-chloro-2,6-dimethylphenyl)hydrazine is Cc1cc(Cl)cc(C)c1NN.
What is the InChIKey of (4-chloro-2,6-dimethylphenyl)hydrazine?
The InChIKey is UDWJARFWDHTWAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN2/c1-5-3-7(9)4-6(2)8(5)11-10/h3-4,11H,10H2,1-2H3.
What are the key properties of (4-chloro-2,6-dimethylphenyl)hydrazine?
(4-chloro-2,6-dimethylphenyl)hydrazine has a molecular weight of 170.64 g/mol, XLogP of 2.24, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-2,6-dimethylphenyl)hydrazine is sourced from PubChem (CID 170985099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).