About (5-chloro-2,3-dihydrocyclopenta[b]pyran-2-yl)methanamine
(5-chloro-2,3-dihydrocyclopenta[b]pyran-2-yl)methanamine (PubChem CID 170985447) has the molecular formula C9H10ClNO
and a molecular weight of 183.64 g/mol. Its IUPAC name is (5-chloro-2,3-dihydrocyclopenta[b]pyran-2-yl)methanamine.
Molecular Properties
| Compound Name | (5-chloro-2,3-dihydrocyclopenta[b]pyran-2-yl)methanamine |
| PubChem CID | 170985447 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | (5-chloro-2,3-dihydrocyclopenta[b]pyran-2-yl)methanamine |
| SMILES | NCC1CC=C2C(Cl)=CC=C2O1 |
| InChI | InChI=1S/C9H10ClNO/c10-8-3-4-9-7(8)2-1-6(5-11)12-9/h2-4,6H,1,5,11H2 |
| InChIKey | YVLHVTRJGBYOIE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-chloro-2,3-dihydrocyclopenta[b]pyran-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-2,3-dihydrocyclopenta[b]pyran-2-yl)methanamine?
The IUPAC name of (5-chloro-2,3-dihydrocyclopenta[b]pyran-2-yl)methanamine (CID 170985447) is (5-chloro-2,3-dihydrocyclopenta[b]pyran-2-yl)methanamine.
What is the SMILES notation for (5-chloro-2,3-dihydrocyclopenta[b]pyran-2-yl)methanamine?
The canonical SMILES for (5-chloro-2,3-dihydrocyclopenta[b]pyran-2-yl)methanamine is NCC1CC=C2C(Cl)=CC=C2O1.
What is the InChIKey of (5-chloro-2,3-dihydrocyclopenta[b]pyran-2-yl)methanamine?
The InChIKey is YVLHVTRJGBYOIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO/c10-8-3-4-9-7(8)2-1-6(5-11)12-9/h2-4,6H,1,5,11H2.
What are the key properties of (5-chloro-2,3-dihydrocyclopenta[b]pyran-2-yl)methanamine?
(5-chloro-2,3-dihydrocyclopenta[b]pyran-2-yl)methanamine has a molecular weight of 183.64 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-2,3-dihydrocyclopenta[b]pyran-2-yl)methanamine is sourced from PubChem (CID 170985447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).