C10H13NO4 — CID 170986081
(furan-3-carbonylamino) 2,2-dimethylpropanoate (PubChem CID 170986081) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is (furan-3-carbonylamino) 2,2-dimethylpropanoate.
| Compound Name | (furan-3-carbonylamino) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 170986081 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (furan-3-carbonylamino) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ONC(=O)c1ccoc1 |
| InChI | InChI=1S/C10H13NO4/c1-10(2,3)9(13)15-11-8(12)7-4-5-14-6-7/h4-6H,1-3H3,(H,11,12) |
| InChIKey | HPGLICKNQXHRBO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|