About 2-[3-(hydroxymethyl)-1,2-oxazol-5-yl]acetic acid
2-[3-(hydroxymethyl)-1,2-oxazol-5-yl]acetic acid (PubChem CID 170986238) has the molecular formula C6H7NO4
and a molecular weight of 157.12 g/mol. Its IUPAC name is 2-[3-(hydroxymethyl)-1,2-oxazol-5-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-(hydroxymethyl)-1,2-oxazol-5-yl]acetic acid |
| PubChem CID | 170986238 |
| Molecular Formula | C6H7NO4 |
| Molecular Weight | 157.12 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | 2-[3-(hydroxymethyl)-1,2-oxazol-5-yl]acetic acid |
| SMILES | O=C(O)Cc1cc(CO)no1 |
| InChI | InChI=1S/C6H7NO4/c8-3-4-1-5(11-7-4)2-6(9)10/h1,8H,2-3H2,(H,9,10) |
| InChIKey | MUKXNQNOCRUWPD-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.12 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(hydroxymethyl)-1,2-oxazol-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(hydroxymethyl)-1,2-oxazol-5-yl]acetic acid?
The IUPAC name of 2-[3-(hydroxymethyl)-1,2-oxazol-5-yl]acetic acid (CID 170986238) is 2-[3-(hydroxymethyl)-1,2-oxazol-5-yl]acetic acid.
What is the SMILES notation for 2-[3-(hydroxymethyl)-1,2-oxazol-5-yl]acetic acid?
The canonical SMILES for 2-[3-(hydroxymethyl)-1,2-oxazol-5-yl]acetic acid is O=C(O)Cc1cc(CO)no1.
What is the InChIKey of 2-[3-(hydroxymethyl)-1,2-oxazol-5-yl]acetic acid?
The InChIKey is MUKXNQNOCRUWPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO4/c8-3-4-1-5(11-7-4)2-6(9)10/h1,8H,2-3H2,(H,9,10).
What are the key properties of 2-[3-(hydroxymethyl)-1,2-oxazol-5-yl]acetic acid?
2-[3-(hydroxymethyl)-1,2-oxazol-5-yl]acetic acid has a molecular weight of 157.12 g/mol, XLogP of -0.21, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(hydroxymethyl)-1,2-oxazol-5-yl]acetic acid is sourced from PubChem (CID 170986238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).