C19H25BO5 — CID 170987183
methyl 7-formyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydronaphthalene-2-carboxylate (PubChem CID 170987183) has the molecular formula C19H25BO5 and a molecular weight of 344.22 g/mol. Its IUPAC name is methyl 7-formyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydronaphthalene-2-carboxylate.
| Compound Name | methyl 7-formyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 170987183 |
| Molecular Formula | C19H25BO5 |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | methyl 7-formyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| SMILES | COC(=O)C1CCc2ccc(C=O)c(B3OC(C)(C)C(C)(C)O3)c2C1 |
| InChI | InChI=1S/C19H25BO5/c1-18(2)19(3,4)25-20(24-18)16-14(11-21)9-7-12-6-8-13(10-15(12)16)17(22)23-5/h7,9,11,13H,6,8,10H2,1-5H3 |
| InChIKey | YBBRYMRXAJEQAQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|